Mercurial > hg > xemacs-beta
view modules/sample/internal/Makefile.in.in @ 4874:4c3f5e1ecbeb
ChangeLog for previous patch: regenerate intl-auto-encap-win32.c
(fix build problems when building --with-msw=no on Cygwin)
-------------------- ChangeLog entries follow: --------------------
lib-src/ChangeLog addition:
2010-01-15 Ben Wing <ben@xemacs.org>
* make-mswin-unicode.pl:
Various fixes to get this to work when using the Cygwin header files
in /usr/include/w32api instead of the VC++ ones:
-- Use /usr/include/w32api as default; don't assume that a passed-in
directory always ends in .../include.
-- Add `const' to list of known type modifiers.
-- If function already seen, warn but don't generate twice.
-- Eliminate `extern' from return type modifiers.
-- Cosmetic: When eliminating APIENTRY, also eliminate following
whitespace.
src/ChangeLog addition:
2010-01-15 Ben Wing <ben@xemacs.org>
* intl-auto-encap-win32.c:
* intl-auto-encap-win32.c (qxeExtractAssociatedIcon):
* intl-auto-encap-win32.c (qxeShellExecuteEx):
* intl-auto-encap-win32.c (qxeSHFileOperation):
* intl-auto-encap-win32.c (qxeSHQueryRecycleBin):
* intl-auto-encap-win32.c (qxeSHEmptyRecycleBin):
* intl-auto-encap-win32.c (qxeWNetAddConnection):
* intl-auto-encap-win32.c (qxeWNetAddConnection2):
* intl-auto-encap-win32.c (qxeWNetAddConnection3):
* intl-auto-encap-win32.c (qxeWNetCancelConnection):
* intl-auto-encap-win32.c (qxeWNetCancelConnection2):
* intl-auto-encap-win32.c (qxeWNetGetConnection):
* intl-auto-encap-win32.c (qxeWNetUseConnection):
* intl-auto-encap-win32.c (qxeWNetConnectionDialog1):
* intl-auto-encap-win32.c (qxeWNetDisconnectDialog1):
* intl-auto-encap-win32.c (qxeWNetOpenEnum):
* intl-auto-encap-win32.c (qxeWNetEnumResource):
* intl-auto-encap-win32.c (qxeWNetGetUniversalName):
* intl-auto-encap-win32.c (qxeWNetGetUser):
* intl-auto-encap-win32.c (qxeWNetGetProviderName):
* intl-auto-encap-win32.c (qxeWNetGetNetworkInformation):
* intl-auto-encap-win32.c (qxeWNetGetLastError):
* intl-auto-encap-win32.c (qxeMultinetGetConnectionPerformance):
* intl-auto-encap-win32.c (qxeAppendMenu):
* intl-auto-encap-win32.c (qxeCopyAcceleratorTable):
* intl-auto-encap-win32.c (qxeDlgDirSelectComboBoxEx):
* intl-auto-encap-win32.c (qxeEnumDesktops):
* intl-auto-encap-win32.c (qxeEnumWindowStations):
* intl-auto-encap-win32.c (qxeGetClassInfo):
* intl-auto-encap-win32.c (qxeGetClassLong):
* intl-auto-encap-win32.c (qxeGetClassName):
* intl-auto-encap-win32.c (qxeGetKeyboardLayoutName):
* intl-auto-encap-win32.c (qxeGetWindowLong):
* intl-auto-encap-win32.c (qxeGetUserObjectInformation):
* intl-auto-encap-win32.c (qxeGetWindowTextLength):
* intl-auto-encap-win32.c (qxeGrayString):
* intl-auto-encap-win32.c (qxeInsertMenu):
* intl-auto-encap-win32.c (qxeSetProp):
* intl-auto-encap-win32.c (qxeEnumICMProfiles):
* intl-auto-encap-win32.c (qxeExtTextOut):
* intl-auto-encap-win32.c (qxeSetICMProfile):
* intl-auto-encap-win32.c (qxeTextOut):
* intl-auto-encap-win32.c (qxeSHGetPathFromIDList):
* intl-auto-encap-win32.c (qxeFindText):
* intl-auto-encap-win32.c (qxeReplaceText):
* intl-auto-encap-win32.c (qxeImmInstallIME):
* intl-auto-encap-win32.c (qxeImmGetDescription):
* intl-auto-encap-win32.c (qxeImmGetIMEFileName):
* intl-auto-encap-win32.c (qxeImmGetCompositionString):
* intl-auto-encap-win32.c (qxeImmGetCandidateListCount):
* intl-auto-encap-win32.c (qxeImmGetCandidateList):
* intl-auto-encap-win32.c (qxeImmGetGuideLine):
* intl-auto-encap-win32.c (qxeImmConfigureIME):
* intl-auto-encap-win32.c (qxeImmEscape):
* intl-auto-encap-win32.c (qxeImmGetConversionList):
* intl-auto-encap-win32.c (qxeImmRegisterWord):
* intl-auto-encap-win32.c (qxeImmUnregisterWord):
* intl-auto-encap-win32.c (qxeImmEnumRegisterWord):
* intl-auto-encap-win32.c (qxesndPlaySound):
* intl-auto-encap-win32.c (qxePlaySound):
* intl-auto-encap-win32.c (qxewaveOutGetErrorText):
* intl-auto-encap-win32.c (qxewaveInGetErrorText):
* intl-auto-encap-win32.c (qxemidiOutGetErrorText):
* intl-auto-encap-win32.c (qxemidiInGetErrorText):
* intl-auto-encap-win32.c (qxemmioStringToFOURCC):
* intl-auto-encap-win32.c (qxemmioInstallIOProc):
* intl-auto-encap-win32.c (qxemmioOpen):
* intl-auto-encap-win32.c (qxemmioRename):
* intl-auto-encap-win32.c (qxemciSendCommand):
* intl-auto-encap-win32.c (qxemciSendString):
* intl-auto-encap-win32.c (qxemciGetDeviceID):
* intl-auto-encap-win32.c (qxemciGetErrorString):
* intl-auto-encap-win32.h:
* intl-auto-encap-win32.h (qxemciGetErrorString):
Regenerate these files from Cygwin headers.
* intl-encap-win32.c:
Bracket more functions in HAVE_MS_WINDOWS, to fix build problems
when building --with-msw=no on Cygwin.
Fixes for Cygwin headers:
-- Comment out IME.H, non-existent in Cygwin.
-- Make MessageBoxIndirect a `no' (don't encapsulate but generate
error if used) because it has a structure parameter that needs
to be A/W split but is declared as FOO*, and our parser can't
split this.
author | Ben Wing <ben@xemacs.org> |
---|---|
date | Fri, 15 Jan 2010 05:12:07 -0600 |
parents | 74b2ea269eb5 |
children | 308d34e9f07d |
line wrap: on
line source
## Makefile for the sample module in XEmacs. ## Copyright (C) 2002 Jerry James. ## This file is part of XEmacs. ## XEmacs is free software; you can redistribute it and/or modify it ## under the terms of the GNU General Public License as published by the ## Free Software Foundation; either version 2, or (at your option) any ## later version. ## XEmacs is distributed in the hope that it will be useful, but WITHOUT ## ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or ## FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License ## for more details. ## You should have received a copy of the GNU General Public License ## along with XEmacs; see the file COPYING. If not, write to ## the Free Software Foundation, Inc., 59 Temple Place - Suite 330, ## Boston, MA 02111-1307, USA. ## Synched up with: Not synched with FSF. ## This is more complicated than would normally be the case, as this makefile ## has been tailored to work both inside and independently of the XEmacs ## source tree, and to support both module and non-module building inside the ## source tree. ### Specialize this part for your module MODNAME=sample MODVER=0.0.1 MODTITLE="Sample module for XEmacs" LDFLAGS=@LDFLAGS@ @sample_libs@ SRCS=sample.c ### You should not need to modify anything below this line SHELL=/bin/sh RM=rm -f PROGNAME=@PROGNAME@ CFLAGS=@CFLAGS@ INSTALL=@INSTALL@ version=@version@ prefix=@prefix@ exec_prefix=@exec_prefix@ libdir=@libdir@ instvardir=@instvardir@ configuration=@configuration@ moduledir=@moduledir@ with_modules=@with_modules@ srcdir=@srcdir@ VPATH=@srcdir@ SRC_SRCS=$(SRCS:%=$(srcdir)/%) OBJS=$(SRCS:.c=.o) CC=@MOD_CC@ MODARCHDIR=@MODARCHDIR@ MAKE_DOCFILE=@MAKE_DOCFILE@ MODCFLAGS=@MODCFLAGS@ INSTALLPATH=@INSTALLPATH@ INSTALL_PROGRAM=@MOD_INSTALL_PROGRAM@ OBJECT_TO_BUILD=@OBJECT_TO_BUILD@ .PHONY: clean distclean install all: $(OBJECT_TO_BUILD) .c.o: $(CC) $(MODCFLAGS) -c $< $(MODNAME).ell: $(OBJS) $(MODNAME)_i.o $(CC) --mode=link --mod-output=$@ $(OBJS) $(MODNAME)_i.o $(LDFLAGS) $(MODNAME)_i.c: $(SRCS) ELLMAKEDOC=$(MAKE_DOCFILE) $(CC) --mode=init --mod-output=$@ \ --mod-name=$(MODNAME) --mod-version=$(MODVER) \ --mod-title=$(MODTITLE) $(SRC_SRCS) clean: $(RM) $(MODNAME).ell $(OBJS) $(MODNAME)_i.* *~ distclean: clean $(RM) Makefile config.* configure install: $(OBJECT_TO_BUILD) $(INSTALL_PROGRAM) $< $(INSTALLPATH)