Mercurial > hg > xemacs-beta
annotate modules/sample/internal/Makefile.in.in @ 4874:4c3f5e1ecbeb
ChangeLog for previous patch: regenerate intl-auto-encap-win32.c
(fix build problems when building --with-msw=no on Cygwin)
-------------------- ChangeLog entries follow: --------------------
lib-src/ChangeLog addition:
2010-01-15 Ben Wing <ben@xemacs.org>
* make-mswin-unicode.pl:
Various fixes to get this to work when using the Cygwin header files
in /usr/include/w32api instead of the VC++ ones:
-- Use /usr/include/w32api as default; don't assume that a passed-in
directory always ends in .../include.
-- Add `const' to list of known type modifiers.
-- If function already seen, warn but don't generate twice.
-- Eliminate `extern' from return type modifiers.
-- Cosmetic: When eliminating APIENTRY, also eliminate following
whitespace.
src/ChangeLog addition:
2010-01-15 Ben Wing <ben@xemacs.org>
* intl-auto-encap-win32.c:
* intl-auto-encap-win32.c (qxeExtractAssociatedIcon):
* intl-auto-encap-win32.c (qxeShellExecuteEx):
* intl-auto-encap-win32.c (qxeSHFileOperation):
* intl-auto-encap-win32.c (qxeSHQueryRecycleBin):
* intl-auto-encap-win32.c (qxeSHEmptyRecycleBin):
* intl-auto-encap-win32.c (qxeWNetAddConnection):
* intl-auto-encap-win32.c (qxeWNetAddConnection2):
* intl-auto-encap-win32.c (qxeWNetAddConnection3):
* intl-auto-encap-win32.c (qxeWNetCancelConnection):
* intl-auto-encap-win32.c (qxeWNetCancelConnection2):
* intl-auto-encap-win32.c (qxeWNetGetConnection):
* intl-auto-encap-win32.c (qxeWNetUseConnection):
* intl-auto-encap-win32.c (qxeWNetConnectionDialog1):
* intl-auto-encap-win32.c (qxeWNetDisconnectDialog1):
* intl-auto-encap-win32.c (qxeWNetOpenEnum):
* intl-auto-encap-win32.c (qxeWNetEnumResource):
* intl-auto-encap-win32.c (qxeWNetGetUniversalName):
* intl-auto-encap-win32.c (qxeWNetGetUser):
* intl-auto-encap-win32.c (qxeWNetGetProviderName):
* intl-auto-encap-win32.c (qxeWNetGetNetworkInformation):
* intl-auto-encap-win32.c (qxeWNetGetLastError):
* intl-auto-encap-win32.c (qxeMultinetGetConnectionPerformance):
* intl-auto-encap-win32.c (qxeAppendMenu):
* intl-auto-encap-win32.c (qxeCopyAcceleratorTable):
* intl-auto-encap-win32.c (qxeDlgDirSelectComboBoxEx):
* intl-auto-encap-win32.c (qxeEnumDesktops):
* intl-auto-encap-win32.c (qxeEnumWindowStations):
* intl-auto-encap-win32.c (qxeGetClassInfo):
* intl-auto-encap-win32.c (qxeGetClassLong):
* intl-auto-encap-win32.c (qxeGetClassName):
* intl-auto-encap-win32.c (qxeGetKeyboardLayoutName):
* intl-auto-encap-win32.c (qxeGetWindowLong):
* intl-auto-encap-win32.c (qxeGetUserObjectInformation):
* intl-auto-encap-win32.c (qxeGetWindowTextLength):
* intl-auto-encap-win32.c (qxeGrayString):
* intl-auto-encap-win32.c (qxeInsertMenu):
* intl-auto-encap-win32.c (qxeSetProp):
* intl-auto-encap-win32.c (qxeEnumICMProfiles):
* intl-auto-encap-win32.c (qxeExtTextOut):
* intl-auto-encap-win32.c (qxeSetICMProfile):
* intl-auto-encap-win32.c (qxeTextOut):
* intl-auto-encap-win32.c (qxeSHGetPathFromIDList):
* intl-auto-encap-win32.c (qxeFindText):
* intl-auto-encap-win32.c (qxeReplaceText):
* intl-auto-encap-win32.c (qxeImmInstallIME):
* intl-auto-encap-win32.c (qxeImmGetDescription):
* intl-auto-encap-win32.c (qxeImmGetIMEFileName):
* intl-auto-encap-win32.c (qxeImmGetCompositionString):
* intl-auto-encap-win32.c (qxeImmGetCandidateListCount):
* intl-auto-encap-win32.c (qxeImmGetCandidateList):
* intl-auto-encap-win32.c (qxeImmGetGuideLine):
* intl-auto-encap-win32.c (qxeImmConfigureIME):
* intl-auto-encap-win32.c (qxeImmEscape):
* intl-auto-encap-win32.c (qxeImmGetConversionList):
* intl-auto-encap-win32.c (qxeImmRegisterWord):
* intl-auto-encap-win32.c (qxeImmUnregisterWord):
* intl-auto-encap-win32.c (qxeImmEnumRegisterWord):
* intl-auto-encap-win32.c (qxesndPlaySound):
* intl-auto-encap-win32.c (qxePlaySound):
* intl-auto-encap-win32.c (qxewaveOutGetErrorText):
* intl-auto-encap-win32.c (qxewaveInGetErrorText):
* intl-auto-encap-win32.c (qxemidiOutGetErrorText):
* intl-auto-encap-win32.c (qxemidiInGetErrorText):
* intl-auto-encap-win32.c (qxemmioStringToFOURCC):
* intl-auto-encap-win32.c (qxemmioInstallIOProc):
* intl-auto-encap-win32.c (qxemmioOpen):
* intl-auto-encap-win32.c (qxemmioRename):
* intl-auto-encap-win32.c (qxemciSendCommand):
* intl-auto-encap-win32.c (qxemciSendString):
* intl-auto-encap-win32.c (qxemciGetDeviceID):
* intl-auto-encap-win32.c (qxemciGetErrorString):
* intl-auto-encap-win32.h:
* intl-auto-encap-win32.h (qxemciGetErrorString):
Regenerate these files from Cygwin headers.
* intl-encap-win32.c:
Bracket more functions in HAVE_MS_WINDOWS, to fix build problems
when building --with-msw=no on Cygwin.
Fixes for Cygwin headers:
-- Comment out IME.H, non-existent in Cygwin.
-- Make MessageBoxIndirect a `no' (don't encapsulate but generate
error if used) because it has a structure parameter that needs
to be A/W split but is declared as FOO*, and our parser can't
split this.
| author | Ben Wing <ben@xemacs.org> |
|---|---|
| date | Fri, 15 Jan 2010 05:12:07 -0600 |
| parents | 74b2ea269eb5 |
| children | 308d34e9f07d |
| rev | line source |
|---|---|
| 996 | 1 ## Makefile for the sample module in XEmacs. |
| 2 ## Copyright (C) 2002 Jerry James. | |
| 3 | |
| 4 ## This file is part of XEmacs. | |
| 5 | |
| 6 ## XEmacs is free software; you can redistribute it and/or modify it | |
| 7 ## under the terms of the GNU General Public License as published by the | |
| 8 ## Free Software Foundation; either version 2, or (at your option) any | |
| 9 ## later version. | |
| 10 | |
| 11 ## XEmacs is distributed in the hope that it will be useful, but WITHOUT | |
| 12 ## ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
| 13 ## FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
| 14 ## for more details. | |
| 15 | |
| 16 ## You should have received a copy of the GNU General Public License | |
| 17 ## along with XEmacs; see the file COPYING. If not, write to | |
| 18 ## the Free Software Foundation, Inc., 59 Temple Place - Suite 330, | |
| 19 ## Boston, MA 02111-1307, USA. | |
| 20 | |
| 21 ## Synched up with: Not synched with FSF. | |
| 22 | |
| 23 ## This is more complicated than would normally be the case, as this makefile | |
| 24 ## has been tailored to work both inside and independently of the XEmacs | |
| 25 ## source tree, and to support both module and non-module building inside the | |
| 26 ## source tree. | |
| 27 | |
| 28 ### Specialize this part for your module | |
| 29 MODNAME=sample | |
| 30 MODVER=0.0.1 | |
| 31 MODTITLE="Sample module for XEmacs" | |
| 32 LDFLAGS=@LDFLAGS@ @sample_libs@ | |
| 33 SRCS=sample.c | |
| 34 | |
| 35 ### You should not need to modify anything below this line | |
| 36 SHELL=/bin/sh | |
| 37 RM=rm -f | |
| 38 PROGNAME=@PROGNAME@ | |
| 39 CFLAGS=@CFLAGS@ | |
| 40 INSTALL=@INSTALL@ | |
| 41 version=@version@ | |
| 42 prefix=@prefix@ | |
| 43 exec_prefix=@exec_prefix@ | |
| 44 libdir=@libdir@ | |
| 45 instvardir=@instvardir@ | |
| 46 configuration=@configuration@ | |
| 47 moduledir=@moduledir@ | |
| 48 with_modules=@with_modules@ | |
| 49 | |
| 50 srcdir=@srcdir@ | |
| 51 VPATH=@srcdir@ | |
| 52 | |
| 1490 | 53 SRC_SRCS=$(SRCS:%=$(srcdir)/%) |
| 54 OBJS=$(SRCS:.c=.o) | |
| 55 | |
| 996 | 56 CC=@MOD_CC@ |
| 57 MODARCHDIR=@MODARCHDIR@ | |
| 58 MAKE_DOCFILE=@MAKE_DOCFILE@ | |
| 59 MODCFLAGS=@MODCFLAGS@ | |
| 60 INSTALLPATH=@INSTALLPATH@ | |
| 61 INSTALL_PROGRAM=@MOD_INSTALL_PROGRAM@ | |
| 62 OBJECT_TO_BUILD=@OBJECT_TO_BUILD@ | |
| 63 | |
| 64 .PHONY: clean distclean install | |
| 65 all: $(OBJECT_TO_BUILD) | |
| 66 | |
| 67 .c.o: | |
| 68 $(CC) $(MODCFLAGS) -c $< | |
| 69 | |
| 70 $(MODNAME).ell: $(OBJS) $(MODNAME)_i.o | |
| 1489 | 71 $(CC) --mode=link --mod-output=$@ $(OBJS) $(MODNAME)_i.o $(LDFLAGS) |
| 996 | 72 |
| 73 $(MODNAME)_i.c: $(SRCS) | |
| 74 ELLMAKEDOC=$(MAKE_DOCFILE) $(CC) --mode=init --mod-output=$@ \ | |
| 75 --mod-name=$(MODNAME) --mod-version=$(MODVER) \ | |
| 76 --mod-title=$(MODTITLE) $(SRC_SRCS) | |
| 77 | |
| 78 clean: | |
| 79 $(RM) $(MODNAME).ell $(OBJS) $(MODNAME)_i.* *~ | |
| 80 | |
| 81 distclean: clean | |
| 82 $(RM) Makefile config.* configure | |
| 83 | |
| 84 install: $(OBJECT_TO_BUILD) | |
| 85 $(INSTALL_PROGRAM) $< $(INSTALLPATH) |