view modules/common/Makefile.common @ 5169:6c6d78781d59

cleanup of code related to xfree(), better KKCC backtrace capabilities, document XD_INLINE_LISP_OBJECT_BLOCK_PTR, fix some memory leaks, other code cleanup -------------------- ChangeLog entries follow: -------------------- src/ChangeLog addition: 2010-03-24 Ben Wing <ben@xemacs.org> * array.h: * array.h (XD_LISP_DYNARR_DESC): * dumper.c (pdump_register_sub): * dumper.c (pdump_store_new_pointer_offsets): * dumper.c (pdump_reloc_one_mc): * elhash.c: * gc.c (lispdesc_one_description_line_size): * gc.c (kkcc_marking): * lrecord.h: * lrecord.h (IF_NEW_GC): * lrecord.h (enum memory_description_type): * lrecord.h (enum data_description_entry_flags): * lrecord.h (struct opaque_convert_functions): Rename XD_LISP_OBJECT_BLOCK_PTR to XD_INLINE_LISP_OBJECT_BLOCK_PTR and document it in lrecord.h. * data.c: * data.c (finish_marking_weak_lists): * data.c (continue_marking_ephemerons): * data.c (finish_marking_ephemerons): * elhash.c (MARK_OBJ): * gc.c: * gc.c (lispdesc_indirect_count_1): * gc.c (struct): * gc.c (kkcc_bt_push): * gc.c (kkcc_gc_stack_push): * gc.c (kkcc_gc_stack_push_lisp_object): * gc.c (kkcc_gc_stack_repush_dirty_object): * gc.c (KKCC_DO_CHECK_FREE): * gc.c (mark_object_maybe_checking_free): * gc.c (mark_struct_contents): * gc.c (mark_lisp_object_block_contents): * gc.c (register_for_finalization): * gc.c (mark_object): * gc.h: * lisp.h: * profile.c: * profile.c (mark_profiling_info_maphash): Clean up KKCC code related to DEBUG_XEMACS. Rename kkcc_backtrace() to kkcc_backtrace_1() and add two params: a `size' arg to control how many stack elements to print and a `detailed' arg to control whether Lisp objects are printed using `debug_print()'. Create front-ends to kkcc_backtrace_1() -- kkcc_detailed_backtrace(), kkcc_short_backtrace(), kkcc_detailed_backtrace_full(), kkcc_short_backtrace_full(), as well as shortened versions kbt(), kbts(), kbtf(), kbtsf() -- to call it with various parameter values. Add an `is_lisp' field to the stack and backtrace structures and use it to keep track of whether an object pushed onto the stack is a Lisp object or a non-Lisp structure; in kkcc_backtrace_1(), don't try to print a non-Lisp structure as a Lisp object. * elhash.c: * extents.c: * file-coding.c: * lrecord.h: * lrecord.h (IF_NEW_GC): * marker.c: * marker.c (Fmarker_buffer): * mule-coding.c: * number.c: * rangetab.c: * specifier.c: New macros IF_OLD_GC(), IF_NEW_GC() to simplify declaration of Lisp objects when a finalizer may exist in one but not the other. Use them appropriately. * extents.c (finalize_extent_info): Don't zero out data->soe and data->extents before trying to free, else we get memory leaks. * lrecord.h (enum lrecord_type): Make the first lrecord type have value 1 not 0 so that 0 remains without implementation and attempts to interpret zeroed memory as a Lisp object will be more obvious. * array.c (Dynarr_free): * device-msw.c (msprinter_delete_device): * device-tty.c (free_tty_device_struct): * device-tty.c (tty_delete_device): * dialog-msw.c (handle_directory_dialog_box): * dialog-x.c: * emacs.c (free_argc_argv): * emodules.c (attempt_module_delete): * file-coding.c (chain_finalize_coding_stream_1): * file-coding.c (chain_finalize_coding_stream): * glyphs-eimage.c: * glyphs-eimage.c (jpeg_instantiate_unwind): * glyphs-eimage.c (gif_instantiate_unwind): * glyphs-eimage.c (png_instantiate_unwind): * glyphs-eimage.c (tiff_instantiate_unwind): * imgproc.c: * imgproc.c (build_EImage_quantable): * insdel.c (uninit_buffer_text): * mule-coding.c (iso2022_finalize_detection_state): * objects-tty.c (tty_finalize_color_instance): * objects-tty.c (tty_finalize_font_instance): * objects-tty.c (tty_font_list): * process.c: * process.c (finalize_process): * redisplay.c (add_propagation_runes): * scrollbar-gtk.c: * scrollbar-gtk.c (gtk_free_scrollbar_instance): * scrollbar-gtk.c (gtk_release_scrollbar_instance): * scrollbar-msw.c: * scrollbar-msw.c (mswindows_free_scrollbar_instance): * scrollbar-msw.c (unshow_that_mofo): * scrollbar-x.c (x_free_scrollbar_instance): * scrollbar-x.c (x_release_scrollbar_instance): * select-x.c: * select-x.c (x_handle_selection_request): * syntax.c: * syntax.c (uninit_buffer_syntax_cache): * text.h (eifree): If possible, whenever we call xfree() on a field in a structure, set the field to 0 afterwards. A lot of code is written so that it checks the value being freed to see if it is non-zero before freeing it -- doing this and setting the value to 0 afterwards ensures (a) we won't try to free twice if the cleanup code is called twice; (b) if the object itself stays around, KKCC won't crash when attempting to mark the freed field. * rangetab.c: Add a finalization method when not NEW_GC to avoid memory leaks. (#### We still get memory leaks when NEW_GC; need to convert gap array to Lisp object).
author Ben Wing <ben@xemacs.org>
date Wed, 24 Mar 2010 01:22:51 -0500
parents c356806cc933
children 308d34e9f07d
line wrap: on
line source

##   Common Makefile section for modules in XEmacs.
##   Copyright (C) 2002 Jerry James.
##   Copyright (C) 2005 Ben Wing.

## This file is part of XEmacs.

## XEmacs is free software; you can redistribute it and/or modify it
## under the terms of the GNU General Public License as published by the
## Free Software Foundation; either version 2, or (at your option) any
## later version.

## XEmacs is distributed in the hope that it will be useful, but WITHOUT
## ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
## FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
## for more details.

## You should have received a copy of the GNU General Public License
## along with XEmacs; see the file COPYING.  If not, write to
## the Free Software Foundation, Inc., 59 Temple Place - Suite 330,
## Boston, MA 02111-1307, USA.

## Synched up with: Not in FSF.

## This is more complicated than would normally be the case, as this makefile
## has been tailored to work both inside and independently of the XEmacs
## source tree, and to support both module and non-module building inside the
## source tree.

## Note: This will be appended to the individual module Makefiles by configure.

#define NOT_C_CODE
#include "../../src/config.h"

SHELL=/bin/sh
RM=rm -f
PROGNAME=@PROGNAME@
CFLAGS=@XE_CFLAGS@
INSTALL=@INSTALL@
version=@version@
prefix=@prefix@
exec_prefix=@exec_prefix@
libdir=@libdir@
instvardir=@instvardir@
configuration=@configuration@
moduledir=@moduledir@
with_modules=@with_modules@

srcdir=@srcdir@
VPATH=@srcdir@

SRC_SRCS=$(SRCS:%=@srcdir@/%)
OBJS=$(SRCS:.c=.o)

MODCC=@MOD_CC@
MODARCHDIR=@MODARCHDIR@
MAKE_DOCFILE=@MAKE_DOCFILE@
MODCFLAGS=@MODCFLAGS@
INSTALLPATH=@INSTALLPATH@
INSTALL_PROGRAM=@MOD_INSTALL_PROGRAM@
OBJECT_TO_BUILD=@OBJECT_TO_BUILD@
LIBSTDCPP=@LIBSTDCPP@
#ifdef WIN32_ANY
IMPORT_LIB=../../src/xemacs-import.a
#endif

.PHONY:	install
all: $(OBJECT_TO_BUILD)

.c.o:
	$(MODCC) $(MODCFLAGS) -c $<

$(MODNAME).ell: $(OBJS) $(MODNAME)_i.o $(IMPORT_LIB)
	$(MODCC) --mode=link --mode=verbose --mod-output=$@ \
	$(OBJS) $(MODNAME)_i.o $(IMPORT_LIB) $(LDFLAGS) $(LIBSTDCPP)

$(MODNAME)_i.c: $(SRCS)
	ELLMAKEDOC=$(MAKE_DOCFILE) $(MODCC) --mode=init --mod-output=$@ \
	--mod-name=$(MODNAME) --mod-version=$(MODVER) \
	--mod-title=$(MODTITLE) $(SRC_SRCS)

.PHONY: mostlyclean clean distclean realclean extraclean
.PHONY: distclean-noconfig realclean-noconfig extraclean-noconfig
mostlyclean:
	-$(RM) $(OBJS) $(MODNAME)_i.* core
clean: mostlyclean
	-$(RM) $(MODNAME).ell
distclean-noconfig: clean
	-$(RM) config.* TAGS
## This is used in making a distribution.
## Do not use it on development directories!
distclean: distclean-noconfig
	-$(RM) GNUmakefile Makefile Makefile.in configure
realclean-noconfig: distclean-noconfig
realclean: distclean
extraclean-noconfig: realclean-noconfig
	-$(RM) *~ \#*
extraclean: realclean
	-$(RM) *~ \#*

install: $(OBJECT_TO_BUILD)
	$(INSTALL_PROGRAM) $< $(INSTALLPATH)

##
## Local Variables:
## mode: makefile
## End:
##