Mercurial > hg > xemacs-beta
annotate modules/common/Makefile.common @ 4906:6ef8256a020a
implement equalp in C, fix case-folding, add equal() method for keymaps
-------------------- ChangeLog entries follow: --------------------
lisp/ChangeLog addition:
2010-02-01 Ben Wing <ben@xemacs.org>
* cl-extra.el:
* cl-extra.el (cl-string-vector-equalp): Removed.
* cl-extra.el (cl-bit-vector-vector-equalp): Removed.
* cl-extra.el (cl-vector-array-equalp): Removed.
* cl-extra.el (cl-hash-table-contents-equalp): Removed.
* cl-extra.el (equalp): Removed.
* cl-extra.el (cl-mapcar-many):
Comment out the whole `equalp' implementation for the moment;
remove once we're sure the C implementation works.
* cl-macs.el:
* cl-macs.el (equalp):
Simplify the compiler-macro for `equalp' -- once it's in C,
we don't need to try so hard to expand it.
src/ChangeLog addition:
2010-02-01 Ben Wing <ben@xemacs.org>
* abbrev.c (abbrev_match_mapper):
* buffer.h (CANON_TABLE_OF):
* buffer.h:
* editfns.c (Fchar_equal):
* minibuf.c (scmp_1):
* text.c (qxestrcasecmp_i18n):
* text.c (qxestrncasecmp_i18n):
* text.c (qxetextcasecmp):
* text.c (qxetextcasecmp_matching):
Create new macro CANONCASE that converts to a canonical mapping
and use it to do caseless comparisons instead of DOWNCASE.
* alloc.c:
* alloc.c (cons_equal):
* alloc.c (vector_equal):
* alloc.c (string_equal):
* bytecode.c (compiled_function_equal):
* chartab.c (char_table_entry_equal):
* chartab.c (char_table_equal):
* data.c (weak_list_equal):
* data.c (weak_box_equal):
* data.c (ephemeron_equal):
* device-msw.c (equal_devmode):
* elhash.c (hash_table_equal):
* events.c (event_equal):
* extents.c (properties_equal):
* extents.c (extent_equal):
* faces.c:
* faces.c (face_equal):
* faces.c (face_hash):
* floatfns.c (float_equal):
* fns.c:
* fns.c (bit_vector_equal):
* fns.c (plists_differ):
* fns.c (Fplists_eq):
* fns.c (Fplists_equal):
* fns.c (Flax_plists_eq):
* fns.c (Flax_plists_equal):
* fns.c (internal_equal):
* fns.c (internal_equalp):
* fns.c (internal_equal_0):
* fns.c (syms_of_fns):
* glyphs.c (image_instance_equal):
* glyphs.c (glyph_equal):
* glyphs.c (glyph_hash):
* gui.c (gui_item_equal):
* lisp.h:
* lrecord.h (struct lrecord_implementation):
* marker.c (marker_equal):
* number.c (bignum_equal):
* number.c (ratio_equal):
* number.c (bigfloat_equal):
* objects.c (color_instance_equal):
* objects.c (font_instance_equal):
* opaque.c (equal_opaque):
* opaque.c (equal_opaque_ptr):
* rangetab.c (range_table_equal):
* specifier.c (specifier_equal):
Add a `foldcase' param to the equal() method and use it to implement
`equalp' comparisons. Also add to plists_differ(), although we
don't currently use it here.
Rewrite internal_equalp(). Implement cross-type vector comparisons.
Don't implement our own handling of numeric promotion -- just use
the `=' primitive.
Add internal_equal_0(), which takes a `foldcase' param and calls
either internal_equal() or internal_equalp().
* buffer.h:
When given a 0 for buffer (which is the norm when functions don't
have a specific buffer available), use the current buffer's table,
not `standard-case-table'; otherwise the current settings are
ignored.
* casetab.c:
* casetab.c (set_case_table):
When handling old-style vectors of 256 in `set-case-table' don't
overwrite the existing table! Instead create a new table and
populate.
* device-msw.c (sync_printer_with_devmode):
* lisp.h:
* text.c (lisp_strcasecmp_ascii):
Rename lisp_strcasecmp to lisp_strcasecmp_ascii and use
lisp_strcasecmp_i18n for caseless comparisons in some places.
* elhash.c:
Delete unused lisp_string_hash and lisp_string_equal().
* events.h:
* keymap-buttons.h:
* keymap.h:
* keymap.c (keymap_lookup_directly):
* keymap.c (keymap_store):
* keymap.c (FROB):
* keymap.c (key_desc_list_to_event):
* keymap.c (describe_map_mapper):
* keymap.c (INCLUDE_BUTTON_ZERO):
New file keymap-buttons.h; use to handle buttons 1-26 in place of
duplicating code 26 times.
* frame-gtk.c (allocate_gtk_frame_struct):
* frame-msw.c (mswindows_init_frame_1):
Fix some comments about internal_equal() in redisplay that don't
apply any more.
* keymap-slots.h:
* keymap.c:
New file keymap-slots.h. Use it to notate the slots in a keymap
structure, similar to frameslots.h or coding-system-slots.h.
* keymap.c (MARKED_SLOT):
* keymap.c (keymap_equal):
* keymap.c (keymap_hash):
Implement.
tests/ChangeLog addition:
2010-02-01 Ben Wing <ben@xemacs.org>
* automated/case-tests.el:
* automated/case-tests.el (uni-mappings):
* automated/search-tests.el:
Delete old pristine-case-table code. Rewrite the Unicode torture
test to take into account whether overlapping mappings exist for
more than one character, and not doing the upcase/downcase
comparisons in such cases.
* automated/lisp-tests.el (foo):
* automated/lisp-tests.el (string-variable):
* automated/lisp-tests.el (featurep):
Replace Assert (equal ... with Assert-equal; same for other types
of equality. Replace some awkward equivalents of Assert-equalp
with Assert-equalp. Add lots of equalp tests.
* automated/case-tests.el:
* automated/regexp-tests.el:
* automated/search-tests.el:
Fix up the comments at the top of the files. Move rules about where
to put tests into case-tests.el.
* automated/test-harness.el:
* automated/test-harness.el (test-harness-aborted-summary-template): New.
* automated/test-harness.el (test-harness-from-buffer):
* automated/test-harness.el (batch-test-emacs):
Fix Assert-test-not. Create Assert-not-equal and variants.
Delete the doc strings from all these convenience functions to avoid
excessive repetition; instead use one copy in a comment.
author | Ben Wing <ben@xemacs.org> |
---|---|
date | Mon, 01 Feb 2010 01:02:40 -0600 |
parents | c356806cc933 |
children | 308d34e9f07d |
rev | line source |
---|---|
1083 | 1 ## Common Makefile section for modules in XEmacs. |
2 ## Copyright (C) 2002 Jerry James. | |
3062 | 3 ## Copyright (C) 2005 Ben Wing. |
1083 | 4 |
5 ## This file is part of XEmacs. | |
6 | |
7 ## XEmacs is free software; you can redistribute it and/or modify it | |
8 ## under the terms of the GNU General Public License as published by the | |
9 ## Free Software Foundation; either version 2, or (at your option) any | |
10 ## later version. | |
11 | |
12 ## XEmacs is distributed in the hope that it will be useful, but WITHOUT | |
13 ## ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
14 ## FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
15 ## for more details. | |
16 | |
17 ## You should have received a copy of the GNU General Public License | |
18 ## along with XEmacs; see the file COPYING. If not, write to | |
19 ## the Free Software Foundation, Inc., 59 Temple Place - Suite 330, | |
20 ## Boston, MA 02111-1307, USA. | |
21 | |
22 ## Synched up with: Not in FSF. | |
23 | |
24 ## This is more complicated than would normally be the case, as this makefile | |
25 ## has been tailored to work both inside and independently of the XEmacs | |
26 ## source tree, and to support both module and non-module building inside the | |
27 ## source tree. | |
28 | |
1111 | 29 ## Note: This will be appended to the individual module Makefiles by configure. |
30 | |
1632 | 31 #define NOT_C_CODE |
32 #include "../../src/config.h" | |
33 | |
1083 | 34 SHELL=/bin/sh |
35 RM=rm -f | |
36 PROGNAME=@PROGNAME@ | |
2377 | 37 CFLAGS=@XE_CFLAGS@ |
1083 | 38 INSTALL=@INSTALL@ |
39 version=@version@ | |
40 prefix=@prefix@ | |
41 exec_prefix=@exec_prefix@ | |
42 libdir=@libdir@ | |
43 instvardir=@instvardir@ | |
44 configuration=@configuration@ | |
45 moduledir=@moduledir@ | |
46 with_modules=@with_modules@ | |
47 | |
48 srcdir=@srcdir@ | |
49 VPATH=@srcdir@ | |
50 | |
1522 | 51 SRC_SRCS=$(SRCS:%=@srcdir@/%) |
1490 | 52 OBJS=$(SRCS:.c=.o) |
53 | |
1252 | 54 MODCC=@MOD_CC@ |
1083 | 55 MODARCHDIR=@MODARCHDIR@ |
56 MAKE_DOCFILE=@MAKE_DOCFILE@ | |
57 MODCFLAGS=@MODCFLAGS@ | |
58 INSTALLPATH=@INSTALLPATH@ | |
59 INSTALL_PROGRAM=@MOD_INSTALL_PROGRAM@ | |
60 OBJECT_TO_BUILD=@OBJECT_TO_BUILD@ | |
1650 | 61 LIBSTDCPP=@LIBSTDCPP@ |
4879
c356806cc933
fix compile errors when --with-msw=no
Ben Wing <ben@xemacs.org>
parents:
3083
diff
changeset
|
62 #ifdef WIN32_ANY |
1632 | 63 IMPORT_LIB=../../src/xemacs-import.a |
64 #endif | |
1083 | 65 |
3062 | 66 .PHONY: install |
1083 | 67 all: $(OBJECT_TO_BUILD) |
68 | |
69 .c.o: | |
1252 | 70 $(MODCC) $(MODCFLAGS) -c $< |
1083 | 71 |
1632 | 72 $(MODNAME).ell: $(OBJS) $(MODNAME)_i.o $(IMPORT_LIB) |
1489 | 73 $(MODCC) --mode=link --mode=verbose --mod-output=$@ \ |
1650 | 74 $(OBJS) $(MODNAME)_i.o $(IMPORT_LIB) $(LDFLAGS) $(LIBSTDCPP) |
1083 | 75 |
76 $(MODNAME)_i.c: $(SRCS) | |
1252 | 77 ELLMAKEDOC=$(MAKE_DOCFILE) $(MODCC) --mode=init --mod-output=$@ \ |
1083 | 78 --mod-name=$(MODNAME) --mod-version=$(MODVER) \ |
79 --mod-title=$(MODTITLE) $(SRC_SRCS) | |
80 | |
3062 | 81 .PHONY: mostlyclean clean distclean realclean extraclean |
82 .PHONY: distclean-noconfig realclean-noconfig extraclean-noconfig | |
83 mostlyclean: | |
3083 | 84 -$(RM) $(OBJS) $(MODNAME)_i.* core |
3062 | 85 clean: mostlyclean |
3083 | 86 -$(RM) $(MODNAME).ell |
3062 | 87 distclean-noconfig: clean |
3083 | 88 -$(RM) config.* TAGS |
3062 | 89 ## This is used in making a distribution. |
90 ## Do not use it on development directories! | |
91 distclean: distclean-noconfig | |
3083 | 92 -$(RM) GNUmakefile Makefile Makefile.in configure |
3062 | 93 realclean-noconfig: distclean-noconfig |
94 realclean: distclean | |
95 extraclean-noconfig: realclean-noconfig | |
3083 | 96 -$(RM) *~ \#* |
3062 | 97 extraclean: realclean |
3083 | 98 -$(RM) *~ \#* |
1083 | 99 |
100 install: $(OBJECT_TO_BUILD) | |
101 $(INSTALL_PROGRAM) $< $(INSTALLPATH) | |
3062 | 102 |
103 ## | |
104 ## Local Variables: | |
105 ## mode: makefile | |
106 ## End: | |
107 ## |