Mercurial > hg > xemacs-beta
annotate modules/common/Makefile.common @ 5169:6c6d78781d59
cleanup of code related to xfree(), better KKCC backtrace capabilities, document XD_INLINE_LISP_OBJECT_BLOCK_PTR, fix some memory leaks, other code cleanup
-------------------- ChangeLog entries follow: --------------------
src/ChangeLog addition:
2010-03-24 Ben Wing <ben@xemacs.org>
* array.h:
* array.h (XD_LISP_DYNARR_DESC):
* dumper.c (pdump_register_sub):
* dumper.c (pdump_store_new_pointer_offsets):
* dumper.c (pdump_reloc_one_mc):
* elhash.c:
* gc.c (lispdesc_one_description_line_size):
* gc.c (kkcc_marking):
* lrecord.h:
* lrecord.h (IF_NEW_GC):
* lrecord.h (enum memory_description_type):
* lrecord.h (enum data_description_entry_flags):
* lrecord.h (struct opaque_convert_functions):
Rename XD_LISP_OBJECT_BLOCK_PTR to XD_INLINE_LISP_OBJECT_BLOCK_PTR
and document it in lrecord.h.
* data.c:
* data.c (finish_marking_weak_lists):
* data.c (continue_marking_ephemerons):
* data.c (finish_marking_ephemerons):
* elhash.c (MARK_OBJ):
* gc.c:
* gc.c (lispdesc_indirect_count_1):
* gc.c (struct):
* gc.c (kkcc_bt_push):
* gc.c (kkcc_gc_stack_push):
* gc.c (kkcc_gc_stack_push_lisp_object):
* gc.c (kkcc_gc_stack_repush_dirty_object):
* gc.c (KKCC_DO_CHECK_FREE):
* gc.c (mark_object_maybe_checking_free):
* gc.c (mark_struct_contents):
* gc.c (mark_lisp_object_block_contents):
* gc.c (register_for_finalization):
* gc.c (mark_object):
* gc.h:
* lisp.h:
* profile.c:
* profile.c (mark_profiling_info_maphash):
Clean up KKCC code related to DEBUG_XEMACS. Rename
kkcc_backtrace() to kkcc_backtrace_1() and add two params: a
`size' arg to control how many stack elements to print and a
`detailed' arg to control whether Lisp objects are printed using
`debug_print()'. Create front-ends to kkcc_backtrace_1() --
kkcc_detailed_backtrace(), kkcc_short_backtrace(),
kkcc_detailed_backtrace_full(), kkcc_short_backtrace_full(), as
well as shortened versions kbt(), kbts(), kbtf(), kbtsf() -- to
call it with various parameter values. Add an `is_lisp' field to
the stack and backtrace structures and use it to keep track of
whether an object pushed onto the stack is a Lisp object or a
non-Lisp structure; in kkcc_backtrace_1(), don't try to print a
non-Lisp structure as a Lisp object.
* elhash.c:
* extents.c:
* file-coding.c:
* lrecord.h:
* lrecord.h (IF_NEW_GC):
* marker.c:
* marker.c (Fmarker_buffer):
* mule-coding.c:
* number.c:
* rangetab.c:
* specifier.c:
New macros IF_OLD_GC(), IF_NEW_GC() to simplify declaration of
Lisp objects when a finalizer may exist in one but not the other.
Use them appropriately.
* extents.c (finalize_extent_info):
Don't zero out data->soe and data->extents before trying to free,
else we get memory leaks.
* lrecord.h (enum lrecord_type):
Make the first lrecord type have value 1 not 0 so that 0 remains
without implementation and attempts to interpret zeroed memory
as a Lisp object will be more obvious.
* array.c (Dynarr_free):
* device-msw.c (msprinter_delete_device):
* device-tty.c (free_tty_device_struct):
* device-tty.c (tty_delete_device):
* dialog-msw.c (handle_directory_dialog_box):
* dialog-x.c:
* emacs.c (free_argc_argv):
* emodules.c (attempt_module_delete):
* file-coding.c (chain_finalize_coding_stream_1):
* file-coding.c (chain_finalize_coding_stream):
* glyphs-eimage.c:
* glyphs-eimage.c (jpeg_instantiate_unwind):
* glyphs-eimage.c (gif_instantiate_unwind):
* glyphs-eimage.c (png_instantiate_unwind):
* glyphs-eimage.c (tiff_instantiate_unwind):
* imgproc.c:
* imgproc.c (build_EImage_quantable):
* insdel.c (uninit_buffer_text):
* mule-coding.c (iso2022_finalize_detection_state):
* objects-tty.c (tty_finalize_color_instance):
* objects-tty.c (tty_finalize_font_instance):
* objects-tty.c (tty_font_list):
* process.c:
* process.c (finalize_process):
* redisplay.c (add_propagation_runes):
* scrollbar-gtk.c:
* scrollbar-gtk.c (gtk_free_scrollbar_instance):
* scrollbar-gtk.c (gtk_release_scrollbar_instance):
* scrollbar-msw.c:
* scrollbar-msw.c (mswindows_free_scrollbar_instance):
* scrollbar-msw.c (unshow_that_mofo):
* scrollbar-x.c (x_free_scrollbar_instance):
* scrollbar-x.c (x_release_scrollbar_instance):
* select-x.c:
* select-x.c (x_handle_selection_request):
* syntax.c:
* syntax.c (uninit_buffer_syntax_cache):
* text.h (eifree):
If possible, whenever we call xfree() on a field in a structure,
set the field to 0 afterwards. A lot of code is written so that
it checks the value being freed to see if it is non-zero before
freeing it -- doing this and setting the value to 0 afterwards
ensures (a) we won't try to free twice if the cleanup code is
called twice; (b) if the object itself stays around, KKCC won't
crash when attempting to mark the freed field.
* rangetab.c:
Add a finalization method when not NEW_GC to avoid memory leaks.
(#### We still get memory leaks when NEW_GC; need to convert gap
array to Lisp object).
author | Ben Wing <ben@xemacs.org> |
---|---|
date | Wed, 24 Mar 2010 01:22:51 -0500 |
parents | c356806cc933 |
children | 308d34e9f07d |
rev | line source |
---|---|
1083 | 1 ## Common Makefile section for modules in XEmacs. |
2 ## Copyright (C) 2002 Jerry James. | |
3062 | 3 ## Copyright (C) 2005 Ben Wing. |
1083 | 4 |
5 ## This file is part of XEmacs. | |
6 | |
7 ## XEmacs is free software; you can redistribute it and/or modify it | |
8 ## under the terms of the GNU General Public License as published by the | |
9 ## Free Software Foundation; either version 2, or (at your option) any | |
10 ## later version. | |
11 | |
12 ## XEmacs is distributed in the hope that it will be useful, but WITHOUT | |
13 ## ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
14 ## FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
15 ## for more details. | |
16 | |
17 ## You should have received a copy of the GNU General Public License | |
18 ## along with XEmacs; see the file COPYING. If not, write to | |
19 ## the Free Software Foundation, Inc., 59 Temple Place - Suite 330, | |
20 ## Boston, MA 02111-1307, USA. | |
21 | |
22 ## Synched up with: Not in FSF. | |
23 | |
24 ## This is more complicated than would normally be the case, as this makefile | |
25 ## has been tailored to work both inside and independently of the XEmacs | |
26 ## source tree, and to support both module and non-module building inside the | |
27 ## source tree. | |
28 | |
1111 | 29 ## Note: This will be appended to the individual module Makefiles by configure. |
30 | |
1632 | 31 #define NOT_C_CODE |
32 #include "../../src/config.h" | |
33 | |
1083 | 34 SHELL=/bin/sh |
35 RM=rm -f | |
36 PROGNAME=@PROGNAME@ | |
2377 | 37 CFLAGS=@XE_CFLAGS@ |
1083 | 38 INSTALL=@INSTALL@ |
39 version=@version@ | |
40 prefix=@prefix@ | |
41 exec_prefix=@exec_prefix@ | |
42 libdir=@libdir@ | |
43 instvardir=@instvardir@ | |
44 configuration=@configuration@ | |
45 moduledir=@moduledir@ | |
46 with_modules=@with_modules@ | |
47 | |
48 srcdir=@srcdir@ | |
49 VPATH=@srcdir@ | |
50 | |
1522 | 51 SRC_SRCS=$(SRCS:%=@srcdir@/%) |
1490 | 52 OBJS=$(SRCS:.c=.o) |
53 | |
1252 | 54 MODCC=@MOD_CC@ |
1083 | 55 MODARCHDIR=@MODARCHDIR@ |
56 MAKE_DOCFILE=@MAKE_DOCFILE@ | |
57 MODCFLAGS=@MODCFLAGS@ | |
58 INSTALLPATH=@INSTALLPATH@ | |
59 INSTALL_PROGRAM=@MOD_INSTALL_PROGRAM@ | |
60 OBJECT_TO_BUILD=@OBJECT_TO_BUILD@ | |
1650 | 61 LIBSTDCPP=@LIBSTDCPP@ |
4879
c356806cc933
fix compile errors when --with-msw=no
Ben Wing <ben@xemacs.org>
parents:
3083
diff
changeset
|
62 #ifdef WIN32_ANY |
1632 | 63 IMPORT_LIB=../../src/xemacs-import.a |
64 #endif | |
1083 | 65 |
3062 | 66 .PHONY: install |
1083 | 67 all: $(OBJECT_TO_BUILD) |
68 | |
69 .c.o: | |
1252 | 70 $(MODCC) $(MODCFLAGS) -c $< |
1083 | 71 |
1632 | 72 $(MODNAME).ell: $(OBJS) $(MODNAME)_i.o $(IMPORT_LIB) |
1489 | 73 $(MODCC) --mode=link --mode=verbose --mod-output=$@ \ |
1650 | 74 $(OBJS) $(MODNAME)_i.o $(IMPORT_LIB) $(LDFLAGS) $(LIBSTDCPP) |
1083 | 75 |
76 $(MODNAME)_i.c: $(SRCS) | |
1252 | 77 ELLMAKEDOC=$(MAKE_DOCFILE) $(MODCC) --mode=init --mod-output=$@ \ |
1083 | 78 --mod-name=$(MODNAME) --mod-version=$(MODVER) \ |
79 --mod-title=$(MODTITLE) $(SRC_SRCS) | |
80 | |
3062 | 81 .PHONY: mostlyclean clean distclean realclean extraclean |
82 .PHONY: distclean-noconfig realclean-noconfig extraclean-noconfig | |
83 mostlyclean: | |
3083 | 84 -$(RM) $(OBJS) $(MODNAME)_i.* core |
3062 | 85 clean: mostlyclean |
3083 | 86 -$(RM) $(MODNAME).ell |
3062 | 87 distclean-noconfig: clean |
3083 | 88 -$(RM) config.* TAGS |
3062 | 89 ## This is used in making a distribution. |
90 ## Do not use it on development directories! | |
91 distclean: distclean-noconfig | |
3083 | 92 -$(RM) GNUmakefile Makefile Makefile.in configure |
3062 | 93 realclean-noconfig: distclean-noconfig |
94 realclean: distclean | |
95 extraclean-noconfig: realclean-noconfig | |
3083 | 96 -$(RM) *~ \#* |
3062 | 97 extraclean: realclean |
3083 | 98 -$(RM) *~ \#* |
1083 | 99 |
100 install: $(OBJECT_TO_BUILD) | |
101 $(INSTALL_PROGRAM) $< $(INSTALLPATH) | |
3062 | 102 |
103 ## | |
104 ## Local Variables: | |
105 ## mode: makefile | |
106 ## End: | |
107 ## |